C15H27N3O — CID 170575324
aziridin-2-yl N,N'-dicyclohexylcarbamimidate (PubChem CID 170575324) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is aziridin-2-yl N,N'-dicyclohexylcarbamimidate.
| Compound Name | aziridin-2-yl N,N'-dicyclohexylcarbamimidate |
|---|---|
| PubChem CID | 170575324 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | aziridin-2-yl N,N'-dicyclohexylcarbamimidate |
| SMILES | C1CCC(/N=C(/NC2CCCCC2)OC2CN2)CC1 |
| InChI | InChI=1S/C15H27N3O/c1-3-7-12(8-4-1)17-15(19-14-11-16-14)18-13-9-5-2-6-10-13/h12-14,16H,1-11H2,(H,17,18) |
| InChIKey | UMNUXJAHAYEIFC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|