C15H27N3 — CID 566641
N,N'-dicyclohexylaziridine-1-carboximidamide (PubChem CID 566641) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is N,N'-dicyclohexylaziridine-1-carboximidamide.
| Compound Name | N,N'-dicyclohexylaziridine-1-carboximidamide |
|---|---|
| PubChem CID | 566641 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | N,N'-dicyclohexylaziridine-1-carboximidamide |
| SMILES | C1CCC(/N=C(/NC2CCCCC2)N2CC2)CC1 |
| InChI | InChI=1S/C15H27N3/c1-3-7-13(8-4-1)16-15(18-11-12-18)17-14-9-5-2-6-10-14/h13-14H,1-12H2,(H,16,17) |
| InChIKey | AMFSNEQDJGTHMC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 27.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|