C18H28N2 — CID 15804073
N,N'-dicyclohexylcyclopenta-2,4-diene-1-carboximidamide (PubChem CID 15804073) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is N,N'-dicyclohexylcyclopenta-2,4-diene-1-carboximidamide.
| Compound Name | N,N'-dicyclohexylcyclopenta-2,4-diene-1-carboximidamide |
|---|---|
| PubChem CID | 15804073 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | N,N'-dicyclohexylcyclopenta-2,4-diene-1-carboximidamide |
| SMILES | C1=CC(/C(=N\C2CCCCC2)NC2CCCCC2)C=C1 |
| InChI | InChI=1S/C18H28N2/c1-3-11-16(12-4-1)19-18(15-9-7-8-10-15)20-17-13-5-2-6-14-17/h7-10,15-17H,1-6,11-14H2,(H,19,20) |
| InChIKey | MGAULZWKPJAEDT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|