C19H41N3Si2 — CID 15398506
2,3-dicyclohexyl-1,1-bis(trimethylsilyl)guanidine (PubChem CID 15398506) has the molecular formula C19H41N3Si2 and a molecular weight of 367.73 g/mol. Its IUPAC name is 2,3-dicyclohexyl-1,1-bis(trimethylsilyl)guanidine.
| Compound Name | 2,3-dicyclohexyl-1,1-bis(trimethylsilyl)guanidine |
|---|---|
| PubChem CID | 15398506 |
| Molecular Formula | C19H41N3Si2 |
| Molecular Weight | 367.73 g/mol |
| Exact Mass | 367.28 |
| IUPAC Name | 2,3-dicyclohexyl-1,1-bis(trimethylsilyl)guanidine |
| SMILES | C[Si](C)(C)N(/C(=N\C1CCCCC1)NC1CCCCC1)[Si](C)(C)C |
| InChI | InChI=1S/C19H41N3Si2/c1-23(2,3)22(24(4,5)6)19(20-17-13-9-7-10-14-17)21-18-15-11-8-12-16-18/h17-18H,7-16H2,1-6H3,(H,20,21) |
| InChIKey | BSHKABZKHMTBAX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.73 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|