C37H72N10O3 — CID 157450332
carbonic acid;bis(2-(N,N'-dicyclohexylcarbamimidoyl)-1,1,3,3-tetramethylguanidine) (PubChem CID 157450332) has the molecular formula C37H72N10O3 and a molecular weight of 705.05 g/mol. Its IUPAC name is carbonic acid;bis(2-(N,N'-dicyclohexylcarbamimidoyl)-1,1,3,3-tetramethylguanidine).
| Compound Name | carbonic acid;bis(2-(N,N'-dicyclohexylcarbamimidoyl)-1,1,3,3-tetramethylguanidine) |
|---|---|
| PubChem CID | 157450332 |
| Molecular Formula | C37H72N10O3 |
| Molecular Weight | 705.05 g/mol |
| Exact Mass | 704.58 |
| IUPAC Name | carbonic acid;bis(2-(N,N'-dicyclohexylcarbamimidoyl)-1,1,3,3-tetramethylguanidine) |
| SMILES | CN(C)C(=N/C(=N\C1CCCCC1)NC1CCCCC1)N(C)C.CN(C)C(=N/C(=N\C1CCCCC1)NC1CCCCC1)N(C)C.O=C(O)O |
| InChI | InChI=1S/2C18H35N5.CH2O3/c2*1-22(2)18(23(3)4)21-17(19-15-11-7-5-8-12-15)20-16-13-9-6-10-14-16;2-1(3)4/h2*15-16H,5-14H2,1-4H3,(H,19,20);(H2,2,3,4) |
| InChIKey | BSSLUTXXEPWZOF-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 143.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.05 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|