C19H38N5O3+ — CID 121302580
carbonic acid;[[(N,N'-dicyclohexylcarbamimidoyl)amino]-(dimethylamino)methylidene]-dimethylazanium (PubChem CID 121302580) has the molecular formula C19H38N5O3+ and a molecular weight of 384.55 g/mol. Its IUPAC name is carbonic acid;[[(N,N'-dicyclohexylcarbamimidoyl)amino]-(dimethylamino)methylidene]-dimethylazanium.
| Compound Name | carbonic acid;[[(N,N'-dicyclohexylcarbamimidoyl)amino]-(dimethylamino)methylidene]-dimethylazanium |
|---|---|
| PubChem CID | 121302580 |
| Molecular Formula | C19H38N5O3+ |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | carbonic acid;[[(N,N'-dicyclohexylcarbamimidoyl)amino]-(dimethylamino)methylidene]-dimethylazanium |
| SMILES | CN(C)C(N/C(=N\C1CCCCC1)NC1CCCCC1)=[N+](C)C.O=C(O)O |
| InChI | InChI=1S/C18H35N5.CH2O3/c1-22(2)18(23(3)4)21-17(19-15-11-7-5-8-12-15)20-16-13-9-6-10-14-16;2-1(3)4/h15-16H,5-14H2,1-4H3,(H,19,20);(H2,2,3,4)/p+1 |
| InChIKey | JIHMTGDINIQDRD-UHFFFAOYSA-O |
| XLogP | 2.60 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|