C16H32N4 — CID 122691193
1-(1-aminopropan-2-yl)-2,3-dicyclohexylguanidine (PubChem CID 122691193) has the molecular formula C16H32N4 and a molecular weight of 280.46 g/mol. Its IUPAC name is 1-(1-aminopropan-2-yl)-2,3-dicyclohexylguanidine.
| Compound Name | 1-(1-aminopropan-2-yl)-2,3-dicyclohexylguanidine |
|---|---|
| PubChem CID | 122691193 |
| Molecular Formula | C16H32N4 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | 1-(1-aminopropan-2-yl)-2,3-dicyclohexylguanidine |
| SMILES | CC(CN)N/C(=N\C1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C16H32N4/c1-13(12-17)18-16(19-14-8-4-2-5-9-14)20-15-10-6-3-7-11-15/h13-15H,2-12,17H2,1H3,(H2,18,19,20) |
| InChIKey | YWJDVQIRXUUCOA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|