C17H34N4 — CID 104888437
1-amino-2-cyclohexyl-3-(3,3,5,5-tetramethylcyclohexyl)guanidine (PubChem CID 104888437) has the molecular formula C17H34N4 and a molecular weight of 294.49 g/mol. Its IUPAC name is 1-amino-2-cyclohexyl-3-(3,3,5,5-tetramethylcyclohexyl)guanidine.
| Compound Name | 1-amino-2-cyclohexyl-3-(3,3,5,5-tetramethylcyclohexyl)guanidine |
|---|---|
| PubChem CID | 104888437 |
| Molecular Formula | C17H34N4 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.28 |
| IUPAC Name | 1-amino-2-cyclohexyl-3-(3,3,5,5-tetramethylcyclohexyl)guanidine |
| SMILES | CC1(C)CC(N/C(=N/C2CCCCC2)NN)CC(C)(C)C1 |
| InChI | InChI=1S/C17H34N4/c1-16(2)10-14(11-17(3,4)12-16)20-15(21-18)19-13-8-6-5-7-9-13/h13-14H,5-12,18H2,1-4H3,(H2,19,20,21) |
| InChIKey | MXUXAQUBWCPXIC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|