C32H60N6 — CID 176525069
1,3-dicyclohexyl-2-[5-[(N,N'-dicyclohexylcarbamimidoyl)amino]-2-methylpentyl]guanidine (PubChem CID 176525069) has the molecular formula C32H60N6 and a molecular weight of 528.87 g/mol. Its IUPAC name is 1,3-dicyclohexyl-2-[5-[(N,N'-dicyclohexylcarbamimidoyl)amino]-2-methylpentyl]guanidine.
| Compound Name | 1,3-dicyclohexyl-2-[5-[(N,N'-dicyclohexylcarbamimidoyl)amino]-2-methylpentyl]guanidine |
|---|---|
| PubChem CID | 176525069 |
| Molecular Formula | C32H60N6 |
| Molecular Weight | 528.87 g/mol |
| Exact Mass | 528.49 |
| IUPAC Name | 1,3-dicyclohexyl-2-[5-[(N,N'-dicyclohexylcarbamimidoyl)amino]-2-methylpentyl]guanidine |
| SMILES | CC(CCCN/C(=N\C1CCCCC1)NC1CCCCC1)CN=C(NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C32H60N6/c1-26(25-34-32(37-29-20-10-4-11-21-29)38-30-22-12-5-13-23-30)15-14-24-33-31(35-27-16-6-2-7-17-27)36-28-18-8-3-9-19-28/h26-30H,2-25H2,1H3,(H2,33,35,36)(H2,34,37,38) |
| InChIKey | GTRBSYMUVSRLLP-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.87 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|