C20H38N4O3 — CID 134346392
1-hydroxypropan-2-yl N-[3-[bis(cyclohexylamino)methylideneamino]propyl]carbamate (PubChem CID 134346392) has the molecular formula C20H38N4O3 and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-hydroxypropan-2-yl N-[3-[bis(cyclohexylamino)methylideneamino]propyl]carbamate.
| Compound Name | 1-hydroxypropan-2-yl N-[3-[bis(cyclohexylamino)methylideneamino]propyl]carbamate |
|---|---|
| PubChem CID | 134346392 |
| Molecular Formula | C20H38N4O3 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | 1-hydroxypropan-2-yl N-[3-[bis(cyclohexylamino)methylideneamino]propyl]carbamate |
| SMILES | CC(CO)OC(=O)NCCCN=C(NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C20H38N4O3/c1-16(15-25)27-20(26)22-14-8-13-21-19(23-17-9-4-2-5-10-17)24-18-11-6-3-7-12-18/h16-18,25H,2-15H2,1H3,(H,22,26)(H2,21,23,24) |
| InChIKey | IPLIDMWKAAZODV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|