C21H42ClN3 — CID 14771737
1,3-dicyclohexyl-2-octylguanidine;hydrochloride (PubChem CID 14771737) has the molecular formula C21H42ClN3 and a molecular weight of 372.04 g/mol. Its IUPAC name is 1,3-dicyclohexyl-2-octylguanidine;hydrochloride.
| Compound Name | 1,3-dicyclohexyl-2-octylguanidine;hydrochloride |
|---|---|
| PubChem CID | 14771737 |
| Molecular Formula | C21H42ClN3 |
| Molecular Weight | 372.04 g/mol |
| Exact Mass | 371.31 |
| IUPAC Name | 1,3-dicyclohexyl-2-octylguanidine;hydrochloride |
| SMILES | CCCCCCCCN=C(NC1CCCCC1)NC1CCCCC1.Cl |
| InChI | InChI=1S/C21H41N3.ClH/c1-2-3-4-5-6-13-18-22-21(23-19-14-9-7-10-15-19)24-20-16-11-8-12-17-20;/h19-20H,2-18H2,1H3,(H2,22,23,24);1H |
| InChIKey | SHRPTKMGOUWHEM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.04 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|