C24H47N3 — CID 123256377
2-butyl-1-cyclohexyl-3-[3-(3,4-dimethylpentan-2-yl)cyclohexyl]guanidine (PubChem CID 123256377) has the molecular formula C24H47N3 and a molecular weight of 377.66 g/mol. Its IUPAC name is 2-butyl-1-cyclohexyl-3-[3-(3,4-dimethylpentan-2-yl)cyclohexyl]guanidine.
| Compound Name | 2-butyl-1-cyclohexyl-3-[3-(3,4-dimethylpentan-2-yl)cyclohexyl]guanidine |
|---|---|
| PubChem CID | 123256377 |
| Molecular Formula | C24H47N3 |
| Molecular Weight | 377.66 g/mol |
| Exact Mass | 377.38 |
| IUPAC Name | 2-butyl-1-cyclohexyl-3-[3-(3,4-dimethylpentan-2-yl)cyclohexyl]guanidine |
| SMILES | CCCC/N=C(\NC1CCCCC1)NC1CCCC(C(C)C(C)C(C)C)C1 |
| InChI | InChI=1S/C24H47N3/c1-6-7-16-25-24(26-22-13-9-8-10-14-22)27-23-15-11-12-21(17-23)20(5)19(4)18(2)3/h18-23H,6-17H2,1-5H3,(H2,25,26,27) |
| InChIKey | XPIARQQRQXOMDZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.66 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|