C34H66N6 — CID 169432043
butan-1-amine;2-butyl-1,3-dicyclohexylguanidine;N,N'-dicyclohexylmethanediimine (PubChem CID 169432043) has the molecular formula C34H66N6 and a molecular weight of 558.94 g/mol. Its IUPAC name is butan-1-amine;2-butyl-1,3-dicyclohexylguanidine;N,N'-dicyclohexylmethanediimine.
| Compound Name | butan-1-amine;2-butyl-1,3-dicyclohexylguanidine;N,N'-dicyclohexylmethanediimine |
|---|---|
| PubChem CID | 169432043 |
| Molecular Formula | C34H66N6 |
| Molecular Weight | 558.94 g/mol |
| Exact Mass | 558.53 |
| IUPAC Name | butan-1-amine;2-butyl-1,3-dicyclohexylguanidine;N,N'-dicyclohexylmethanediimine |
| SMILES | C(=NC1CCCCC1)=NC1CCCCC1.CCCCN.CCCCN=C(NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C17H33N3.C13H22N2.C4H11N/c1-2-3-14-18-17(19-15-10-6-4-7-11-15)20-16-12-8-5-9-13-16;1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;1-2-3-4-5/h15-16H,2-14H2,1H3,(H2,18,19,20);12-13H,1-10H2;2-5H2,1H3 |
| InChIKey | ZOYMDJARHXVCKZ-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.94 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|