C38H73N7 — CID 176523791
1,3-dicyclohexyl-2-[6-[6-[(N,N'-dicyclohexylcarbamimidoyl)amino]hexylamino]hexyl]guanidine (PubChem CID 176523791) has the molecular formula C38H73N7 and a molecular weight of 628.05 g/mol. Its IUPAC name is 1,3-dicyclohexyl-2-[6-[6-[(N,N'-dicyclohexylcarbamimidoyl)amino]hexylamino]hexyl]guanidine.
| Compound Name | 1,3-dicyclohexyl-2-[6-[6-[(N,N'-dicyclohexylcarbamimidoyl)amino]hexylamino]hexyl]guanidine |
|---|---|
| PubChem CID | 176523791 |
| Molecular Formula | C38H73N7 |
| Molecular Weight | 628.05 g/mol |
| Exact Mass | 627.59 |
| IUPAC Name | 1,3-dicyclohexyl-2-[6-[6-[(N,N'-dicyclohexylcarbamimidoyl)amino]hexylamino]hexyl]guanidine |
| SMILES | C(CCCNCCCCCCN/C(=N\C1CCCCC1)NC1CCCCC1)CCN=C(NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C38H73N7/c1(3-19-31-40-37(42-33-21-9-5-10-22-33)43-34-23-11-6-12-24-34)17-29-39-30-18-2-4-20-32-41-38(44-35-25-13-7-14-26-35)45-36-27-15-8-16-28-36/h33-36,39H,1-32H2,(H2,40,42,43)(H2,41,44,45) |
| InChIKey | FUTUOGIRJUAPFE-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.05 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|