C23H43N3O2 — CID 22974457
1,3-dicyclohexyl-2-[6-(prop-1-en-2-yloxymethoxy)hexyl]guanidine (PubChem CID 22974457) has the molecular formula C23H43N3O2 and a molecular weight of 393.62 g/mol. Its IUPAC name is 1,3-dicyclohexyl-2-[6-(prop-1-en-2-yloxymethoxy)hexyl]guanidine.
| Compound Name | 1,3-dicyclohexyl-2-[6-(prop-1-en-2-yloxymethoxy)hexyl]guanidine |
|---|---|
| PubChem CID | 22974457 |
| Molecular Formula | C23H43N3O2 |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 393.34 |
| IUPAC Name | 1,3-dicyclohexyl-2-[6-(prop-1-en-2-yloxymethoxy)hexyl]guanidine |
| SMILES | C=C(C)OCOCCCCCCN=C(NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C23H43N3O2/c1-20(2)28-19-27-18-12-4-3-11-17-24-23(25-21-13-7-5-8-14-21)26-22-15-9-6-10-16-22/h21-22H,1,3-19H2,2H3,(H2,24,25,26) |
| InChIKey | DTZDFKUNRFHDLC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|