C21H40N4 — CID 129246032
1,3-dicyclohexyl-2-[2-(cyclohexylamino)ethyl]guanidine (PubChem CID 129246032) has the molecular formula C21H40N4 and a molecular weight of 348.58 g/mol. Its IUPAC name is 1,3-dicyclohexyl-2-[2-(cyclohexylamino)ethyl]guanidine.
| Compound Name | 1,3-dicyclohexyl-2-[2-(cyclohexylamino)ethyl]guanidine |
|---|---|
| PubChem CID | 129246032 |
| Molecular Formula | C21H40N4 |
| Molecular Weight | 348.58 g/mol |
| Exact Mass | 348.33 |
| IUPAC Name | 1,3-dicyclohexyl-2-[2-(cyclohexylamino)ethyl]guanidine |
| SMILES | C1CCC(NCCN=C(NC2CCCCC2)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C21H40N4/c1-4-10-18(11-5-1)22-16-17-23-21(24-19-12-6-2-7-13-19)25-20-14-8-3-9-15-20/h18-20,22H,1-17H2,(H2,23,24,25) |
| InChIKey | DMUVTFZNSOHUDO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|