C29H54N6 — CID 20762626
2-[3-[bis(cyclohexylamino)methylideneamino]propyl]-1,3-dicyclohexylguanidine (PubChem CID 20762626) has the molecular formula C29H54N6 and a molecular weight of 486.79 g/mol. Its IUPAC name is 2-[3-[bis(cyclohexylamino)methylideneamino]propyl]-1,3-dicyclohexylguanidine.
| Compound Name | 2-[3-[bis(cyclohexylamino)methylideneamino]propyl]-1,3-dicyclohexylguanidine |
|---|---|
| PubChem CID | 20762626 |
| Molecular Formula | C29H54N6 |
| Molecular Weight | 486.79 g/mol |
| Exact Mass | 486.44 |
| IUPAC Name | 2-[3-[bis(cyclohexylamino)methylideneamino]propyl]-1,3-dicyclohexylguanidine |
| SMILES | C1CCC(NC(=NCCCN=C(NC2CCCCC2)NC2CCCCC2)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C29H54N6/c1-5-14-24(15-6-1)32-28(33-25-16-7-2-8-17-25)30-22-13-23-31-29(34-26-18-9-3-10-19-26)35-27-20-11-4-12-21-27/h24-27H,1-23H2,(H2,30,32,33)(H2,31,34,35) |
| InChIKey | DMCMZYNJCPSGKG-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.79 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|