C24H45N5O — CID 122691224
(Z)-3-[3-[bis(cyclohexylamino)methylideneamino]propylamino]-N,N-diethylbut-2-enamide (PubChem CID 122691224) has the molecular formula C24H45N5O and a molecular weight of 419.66 g/mol. Its IUPAC name is (Z)-3-[3-[bis(cyclohexylamino)methylideneamino]propylamino]-N,N-diethylbut-2-enamide.
| Compound Name | (Z)-3-[3-[bis(cyclohexylamino)methylideneamino]propylamino]-N,N-diethylbut-2-enamide |
|---|---|
| PubChem CID | 122691224 |
| Molecular Formula | C24H45N5O |
| Molecular Weight | 419.66 g/mol |
| Exact Mass | 419.36 |
| IUPAC Name | (Z)-3-[3-[bis(cyclohexylamino)methylideneamino]propylamino]-N,N-diethylbut-2-enamide |
| SMILES | CCN(CC)C(=O)/C=C(/C)NCCCN=C(NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C24H45N5O/c1-4-29(5-2)23(30)19-20(3)25-17-12-18-26-24(27-21-13-8-6-9-14-21)28-22-15-10-7-11-16-22/h19,21-22,25H,4-18H2,1-3H3,(H2,26,27,28)/b20-19- |
| InChIKey | YXEAQHATJNVLAT-VXPUYCOJSA-N |
| XLogP | 3.94 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.66 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|