C17H33N4+ — CID 159536560
1-[(N,N'-dicyclohexylcarbamimidoyl)amino]ethylidene-dimethylazanium (PubChem CID 159536560) has the molecular formula C17H33N4+ and a molecular weight of 293.48 g/mol. Its IUPAC name is 1-[(N,N'-dicyclohexylcarbamimidoyl)amino]ethylidene-dimethylazanium.
| Compound Name | 1-[(N,N'-dicyclohexylcarbamimidoyl)amino]ethylidene-dimethylazanium |
|---|---|
| PubChem CID | 159536560 |
| Molecular Formula | C17H33N4+ |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | 1-[(N,N'-dicyclohexylcarbamimidoyl)amino]ethylidene-dimethylazanium |
| SMILES | CC(N/C(=N\C1CCCCC1)NC1CCCCC1)=[N+](C)C |
| InChI | InChI=1S/C17H32N4/c1-14(21(2)3)18-17(19-15-10-6-4-7-11-15)20-16-12-8-5-9-13-16/h15-16H,4-13H2,1-3H3,(H,19,20)/p+1 |
| InChIKey | ZBQYPQWDOZLHND-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 39.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|