C18H29IN4 — CID 154879292
1,2-dicyclohexyl-3-pyridin-1-ium-1-ylguanidine iodide (PubChem CID 154879292) has the molecular formula C18H29IN4 and a molecular weight of 428.36 g/mol. Its IUPAC name is 1,2-dicyclohexyl-3-pyridin-1-ium-1-ylguanidine iodide.
| Compound Name | 1,2-dicyclohexyl-3-pyridin-1-ium-1-ylguanidine iodide |
|---|---|
| PubChem CID | 154879292 |
| Molecular Formula | C18H29IN4 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 1,2-dicyclohexyl-3-pyridin-1-ium-1-ylguanidine iodide |
| SMILES | [I-].c1cc[n+](N/C(=N\C2CCCCC2)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C18H29N4.HI/c1-4-10-16(11-5-1)19-18(20-17-12-6-2-7-13-17)21-22-14-8-3-9-15-22;/h3,8-9,14-17H,1-2,4-7,10-13H2,(H2,19,20,21);1H/q+1;/p-1 |
| InChIKey | JIZHHKCMTZJILF-UHFFFAOYSA-M |
| XLogP | 0.13 |
| TPSA | 40.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|