C20H31N3O — CID 10426726
1,2-dicyclohexyl-3-phenylmethoxyguanidine (PubChem CID 10426726) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is 1,2-dicyclohexyl-3-phenylmethoxyguanidine.
| Compound Name | 1,2-dicyclohexyl-3-phenylmethoxyguanidine |
|---|---|
| PubChem CID | 10426726 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | 1,2-dicyclohexyl-3-phenylmethoxyguanidine |
| SMILES | c1ccc(CON/C(=N\C2CCCCC2)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C20H31N3O/c1-4-10-17(11-5-1)16-24-23-20(21-18-12-6-2-7-13-18)22-19-14-8-3-9-15-19/h1,4-5,10-11,18-19H,2-3,6-9,12-16H2,(H2,21,22,23) |
| InChIKey | VQVVFRAPNOWJGG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|