C20H29ClN2O — CID 141252605
(2-chlorophenyl)methyl N,N'-dicyclohexylcarbamimidate (PubChem CID 141252605) has the molecular formula C20H29ClN2O and a molecular weight of 348.92 g/mol. Its IUPAC name is (2-chlorophenyl)methyl N,N'-dicyclohexylcarbamimidate.
| Compound Name | (2-chlorophenyl)methyl N,N'-dicyclohexylcarbamimidate |
|---|---|
| PubChem CID | 141252605 |
| Molecular Formula | C20H29ClN2O |
| Molecular Weight | 348.92 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (2-chlorophenyl)methyl N,N'-dicyclohexylcarbamimidate |
| SMILES | Clc1ccccc1CO/C(=N\C1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C20H29ClN2O/c21-19-14-8-7-9-16(19)15-24-20(22-17-10-3-1-4-11-17)23-18-12-5-2-6-13-18/h7-9,14,17-18H,1-6,10-13,15H2,(H,22,23) |
| InChIKey | PWEXJVUEYVIJIW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.92 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|