C29H47N3O2 — CID 90959885
(2,2,6,6-tetramethyl-4-phenylmethoxypiperidin-1-yl) N,N'-dicyclohexylcarbamimidate (PubChem CID 90959885) has the molecular formula C29H47N3O2 and a molecular weight of 469.71 g/mol. Its IUPAC name is (2,2,6,6-tetramethyl-4-phenylmethoxypiperidin-1-yl) N,N'-dicyclohexylcarbamimidate.
| Compound Name | (2,2,6,6-tetramethyl-4-phenylmethoxypiperidin-1-yl) N,N'-dicyclohexylcarbamimidate |
|---|---|
| PubChem CID | 90959885 |
| Molecular Formula | C29H47N3O2 |
| Molecular Weight | 469.71 g/mol |
| Exact Mass | 469.37 |
| IUPAC Name | (2,2,6,6-tetramethyl-4-phenylmethoxypiperidin-1-yl) N,N'-dicyclohexylcarbamimidate |
| SMILES | CC1(C)CC(OCc2ccccc2)CC(C)(C)N1O/C(=N/C1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C29H47N3O2/c1-28(2)20-26(33-22-23-14-8-5-9-15-23)21-29(3,4)32(28)34-27(30-24-16-10-6-11-17-24)31-25-18-12-7-13-19-25/h5,8-9,14-15,24-26H,6-7,10-13,16-22H2,1-4H3,(H,30,31) |
| InChIKey | YDRNDCCCIIQSRB-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.71 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|