C21H32N2O — CID 11727199
2-phenylethyl N,N'-dicyclohexylcarbamimidate (PubChem CID 11727199) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is 2-phenylethyl N,N'-dicyclohexylcarbamimidate.
| Compound Name | 2-phenylethyl N,N'-dicyclohexylcarbamimidate |
|---|---|
| PubChem CID | 11727199 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | 2-phenylethyl N,N'-dicyclohexylcarbamimidate |
| SMILES | c1ccc(CCO/C(=N\C2CCCCC2)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C21H32N2O/c1-4-10-18(11-5-1)16-17-24-21(22-19-12-6-2-7-13-19)23-20-14-8-3-9-15-20/h1,4-5,10-11,19-20H,2-3,6-9,12-17H2,(H,22,23) |
| InChIKey | BJHBNKLGOIXHRF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|