C21H33N3 — CID 101415445
2,3-dicyclohexyl-1-methyl-1-(4-methylphenyl)guanidine (PubChem CID 101415445) has the molecular formula C21H33N3 and a molecular weight of 327.52 g/mol. Its IUPAC name is 2,3-dicyclohexyl-1-methyl-1-(4-methylphenyl)guanidine.
| Compound Name | 2,3-dicyclohexyl-1-methyl-1-(4-methylphenyl)guanidine |
|---|---|
| PubChem CID | 101415445 |
| Molecular Formula | C21H33N3 |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.27 |
| IUPAC Name | 2,3-dicyclohexyl-1-methyl-1-(4-methylphenyl)guanidine |
| SMILES | Cc1ccc(N(C)/C(=N/C2CCCCC2)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C21H33N3/c1-17-13-15-20(16-14-17)24(2)21(22-18-9-5-3-6-10-18)23-19-11-7-4-8-12-19/h13-16,18-19H,3-12H2,1-2H3,(H,22,23) |
| InChIKey | CZDAJYYRKSYCKM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|