C29H65N3O3Si4 — CID 58159276
1-butyl-2,3-dicyclohexyl-1-[3-tris(trimethylsilyloxy)silylpropyl]guanidine (PubChem CID 58159276) has the molecular formula C29H65N3O3Si4 and a molecular weight of 616.20 g/mol. Its IUPAC name is 1-butyl-2,3-dicyclohexyl-1-[3-tris(trimethylsilyloxy)silylpropyl]guanidine.
| Compound Name | 1-butyl-2,3-dicyclohexyl-1-[3-tris(trimethylsilyloxy)silylpropyl]guanidine |
|---|---|
| PubChem CID | 58159276 |
| Molecular Formula | C29H65N3O3Si4 |
| Molecular Weight | 616.20 g/mol |
| Exact Mass | 615.41 |
| IUPAC Name | 1-butyl-2,3-dicyclohexyl-1-[3-tris(trimethylsilyloxy)silylpropyl]guanidine |
| SMILES | CCCCN(CCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)/C(=N\C1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C29H65N3O3Si4/c1-11-12-24-32(29(30-27-20-15-13-16-21-27)31-28-22-17-14-18-23-28)25-19-26-39(33-36(2,3)4,34-37(5,6)7)35-38(8,9)10/h27-28H,11-26H2,1-10H3,(H,30,31) |
| InChIKey | FXBRMTBPISPTHE-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.20 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|