C39H77N5O3Si — CID 161494061
(E)-1-N'-butyl-1-N,2-dicyclohexyl-1-N'-methylethene-1,1-diamine;N,N'-dicyclohexylmethanediimine;N-methyl-3-trimethoxysilylpropan-1-amine (PubChem CID 161494061) has the molecular formula C39H77N5O3Si and a molecular weight of 692.16 g/mol. Its IUPAC name is (E)-1-N'-butyl-1-N,2-dicyclohexyl-1-N'-methylethene-1,1-diamine;N,N'-dicyclohexylmethanediimine;N-methyl-3-trimethoxysilylpropan-1-amine.
| Compound Name | (E)-1-N'-butyl-1-N,2-dicyclohexyl-1-N'-methylethene-1,1-diamine;N,N'-dicyclohexylmethanediimine;N-methyl-3-trimethoxysilylpropan-1-amine |
|---|---|
| PubChem CID | 161494061 |
| Molecular Formula | C39H77N5O3Si |
| Molecular Weight | 692.16 g/mol |
| Exact Mass | 691.58 |
| IUPAC Name | (E)-1-N'-butyl-1-N,2-dicyclohexyl-1-N'-methylethene-1,1-diamine;N,N'-dicyclohexylmethanediimine;N-methyl-3-trimethoxysilylpropan-1-amine |
| SMILES | C(=NC1CCCCC1)=NC1CCCCC1.CCCCN(C)/C(=C/C1CCCCC1)NC1CCCCC1.CNCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C19H36N2.C13H22N2.C7H19NO3Si/c1-3-4-15-21(2)19(16-17-11-7-5-8-12-17)20-18-13-9-6-10-14-18;1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;1-8-6-5-7-12(9-2,10-3)11-4/h16-18,20H,3-15H2,1-2H3;12-13H,1-10H2;8H,5-7H2,1-4H3/b19-16+;; |
| InChIKey | WFYWJLNCIUVFFK-JWZFBPJHSA-N |
| XLogP | 9.36 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.16 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|