C28H66N6O6Si2 — CID 159024992
N,N'-di(propan-2-yl)methanediimine;1-methyl-2,3-di(propan-2-yl)-1-(3-trimethoxysilylpropyl)guanidine;N-methyl-3-trimethoxysilylpropan-1-amine (PubChem CID 159024992) has the molecular formula C28H66N6O6Si2 and a molecular weight of 639.04 g/mol. Its IUPAC name is N,N'-di(propan-2-yl)methanediimine;1-methyl-2,3-di(propan-2-yl)-1-(3-trimethoxysilylpropyl)guanidine;N-methyl-3-trimethoxysilylpropan-1-amine.
| Compound Name | N,N'-di(propan-2-yl)methanediimine;1-methyl-2,3-di(propan-2-yl)-1-(3-trimethoxysilylpropyl)guanidine;N-methyl-3-trimethoxysilylpropan-1-amine |
|---|---|
| PubChem CID | 159024992 |
| Molecular Formula | C28H66N6O6Si2 |
| Molecular Weight | 639.04 g/mol |
| Exact Mass | 638.46 |
| IUPAC Name | N,N'-di(propan-2-yl)methanediimine;1-methyl-2,3-di(propan-2-yl)-1-(3-trimethoxysilylpropyl)guanidine;N-methyl-3-trimethoxysilylpropan-1-amine |
| SMILES | CC(C)N=C=NC(C)C.CNCCC[Si](OC)(OC)OC.CO[Si](CCCN(C)/C(=N/C(C)C)NC(C)C)(OC)OC |
| InChI | InChI=1S/C14H33N3O3Si.C7H14N2.C7H19NO3Si/c1-12(2)15-14(16-13(3)4)17(5)10-9-11-21(18-6,19-7)20-8;1-6(2)8-5-9-7(3)4;1-8-6-5-7-12(9-2,10-3)11-4/h12-13H,9-11H2,1-8H3,(H,15,16);6-7H,1-4H3;8H,5-7H2,1-4H3 |
| InChIKey | JUECLXVHOLUSQT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 119.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.04 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|