C37H73N6O3Si+ — CID 66921341
bis(cyclohexylamino)methylidene-[cyclohexyl-(N-cyclohexyl-N'-ethylcarbamimidoyl)amino]-(3-triethoxysilylpropyl)azanium (PubChem CID 66921341) has the molecular formula C37H73N6O3Si+ and a molecular weight of 678.12 g/mol. Its IUPAC name is bis(cyclohexylamino)methylidene-[cyclohexyl-(N-cyclohexyl-N'-ethylcarbamimidoyl)amino]-(3-triethoxysilylpropyl)azanium.
| Compound Name | bis(cyclohexylamino)methylidene-[cyclohexyl-(N-cyclohexyl-N'-ethylcarbamimidoyl)amino]-(3-triethoxysilylpropyl)azanium |
|---|---|
| PubChem CID | 66921341 |
| Molecular Formula | C37H73N6O3Si+ |
| Molecular Weight | 678.12 g/mol |
| Exact Mass | 677.55 |
| IUPAC Name | bis(cyclohexylamino)methylidene-[cyclohexyl-(N-cyclohexyl-N'-ethylcarbamimidoyl)amino]-(3-triethoxysilylpropyl)azanium |
| SMILES | CC/N=C(\NC1CCCCC1)N(C1CCCCC1)[N+](CCC[Si](OCC)(OCC)OCC)=C(NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C37H72N6O3Si/c1-5-38-36(39-32-22-13-9-14-23-32)43(35-28-19-12-20-29-35)42(30-21-31-47(44-6-2,45-7-3)46-8-4)37(40-33-24-15-10-16-25-33)41-34-26-17-11-18-27-34/h32-35H,5-31H2,1-4H3,(H2,38,39,40,41)/p+1 |
| InChIKey | XEAIVDDQEIDZDI-UHFFFAOYSA-O |
| XLogP | 7.49 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.12 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|