C31H56N2O2 — CID 10929055
(N,N'-dicyclohexylcarbamimidoyl) (E)-octadec-9-enoate (PubChem CID 10929055) has the molecular formula C31H56N2O2 and a molecular weight of 488.80 g/mol. Its IUPAC name is (N,N'-dicyclohexylcarbamimidoyl) (E)-octadec-9-enoate.
| Compound Name | (N,N'-dicyclohexylcarbamimidoyl) (E)-octadec-9-enoate |
|---|---|
| PubChem CID | 10929055 |
| Molecular Formula | C31H56N2O2 |
| Molecular Weight | 488.80 g/mol |
| Exact Mass | 488.43 |
| IUPAC Name | (N,N'-dicyclohexylcarbamimidoyl) (E)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)O/C(=N/C1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C31H56N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-22-27-30(34)35-31(32-28-23-18-16-19-24-28)33-29-25-20-17-21-26-29/h9-10,28-29H,2-8,11-27H2,1H3,(H,32,33)/b10-9+ |
| InChIKey | YJBXBQZEQZMXJV-MDZDMXLPSA-N |
| XLogP | 9.18 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.80 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|