C17H32N3O+ — CID 59981783
N,N'-dicyclohexylmorpholin-4-ium-4-carboximidamide (PubChem CID 59981783) has the molecular formula C17H32N3O+ and a molecular weight of 294.46 g/mol. Its IUPAC name is N,N'-dicyclohexylmorpholin-4-ium-4-carboximidamide.
| Compound Name | N,N'-dicyclohexylmorpholin-4-ium-4-carboximidamide |
|---|---|
| PubChem CID | 59981783 |
| Molecular Formula | C17H32N3O+ |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | N,N'-dicyclohexylmorpholin-4-ium-4-carboximidamide |
| SMILES | C1CCC(/N=C(/NC2CCCCC2)[NH+]2CCOCC2)CC1 |
| InChI | InChI=1S/C17H31N3O/c1-3-7-15(8-4-1)18-17(20-11-13-21-14-12-20)19-16-9-5-2-6-10-16/h15-16H,1-14H2,(H,18,19)/p+1 |
| InChIKey | OZNYZQOTXQSUJM-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|