C20H28N4 — CID 139093660
N,N'-dicyclohexylbenzimidazole-1-carboximidamide (PubChem CID 139093660) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is N,N'-dicyclohexylbenzimidazole-1-carboximidamide.
| Compound Name | N,N'-dicyclohexylbenzimidazole-1-carboximidamide |
|---|---|
| PubChem CID | 139093660 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | N,N'-dicyclohexylbenzimidazole-1-carboximidamide |
| SMILES | c1ccc2c(c1)ncn2/C(=N\C1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C20H28N4/c1-3-9-16(10-4-1)22-20(23-17-11-5-2-6-12-17)24-15-21-18-13-7-8-14-19(18)24/h7-8,13-17H,1-6,9-12H2,(H,22,23) |
| InChIKey | IPHDAIKYNIJCHL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|