C14H25N3O3S — CID 87475251
(N,N'-dicyclohexylcarbamimidoyl)peroxycarbamothioic S-acid (PubChem CID 87475251) has the molecular formula C14H25N3O3S and a molecular weight of 315.44 g/mol. Its IUPAC name is (N,N'-dicyclohexylcarbamimidoyl)peroxycarbamothioic S-acid.
| Compound Name | (N,N'-dicyclohexylcarbamimidoyl)peroxycarbamothioic S-acid |
|---|---|
| PubChem CID | 87475251 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (N,N'-dicyclohexylcarbamimidoyl)peroxycarbamothioic S-acid |
| SMILES | O=C(S)NOO/C(=N\C1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C14H25N3O3S/c18-14(21)17-20-19-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h11-12H,1-10H2,(H,15,16)(H2,17,18,21) |
| InChIKey | YMOLFCWOTALCNT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|