C23H32N4O3 — CID 6244861
(N,N'-dicyclohexylcarbamimidoyl) (2E)-2-(acetylhydrazinylidene)-2-phenylacetate (PubChem CID 6244861) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is (N,N'-dicyclohexylcarbamimidoyl) (2E)-2-(acetylhydrazinylidene)-2-phenylacetate.
| Compound Name | (N,N'-dicyclohexylcarbamimidoyl) (2E)-2-(acetylhydrazinylidene)-2-phenylacetate |
|---|---|
| PubChem CID | 6244861 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | (N,N'-dicyclohexylcarbamimidoyl) (2E)-2-(acetylhydrazinylidene)-2-phenylacetate |
| SMILES | CC(=O)N/N=C(/C(=O)O/C(=N/C1CCCCC1)NC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H32N4O3/c1-17(28)26-27-21(18-11-5-2-6-12-18)22(29)30-23(24-19-13-7-3-8-14-19)25-20-15-9-4-10-16-20/h2,5-6,11-12,19-20H,3-4,7-10,13-16H2,1H3,(H,24,25)(H,26,28)/b27-21+ |
| InChIKey | YQGMZJXQPQLVLX-SZXQPVLSSA-N |
| XLogP | 3.68 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|