C30H49N3O2 — CID 102463131
(N,N'-dicyclohexylcarbamimidoyl) 2-[(3,5-ditert-butylphenyl)methylamino]acetate (PubChem CID 102463131) has the molecular formula C30H49N3O2 and a molecular weight of 483.74 g/mol. Its IUPAC name is (N,N'-dicyclohexylcarbamimidoyl) 2-[(3,5-ditert-butylphenyl)methylamino]acetate.
| Compound Name | (N,N'-dicyclohexylcarbamimidoyl) 2-[(3,5-ditert-butylphenyl)methylamino]acetate |
|---|---|
| PubChem CID | 102463131 |
| Molecular Formula | C30H49N3O2 |
| Molecular Weight | 483.74 g/mol |
| Exact Mass | 483.38 |
| IUPAC Name | (N,N'-dicyclohexylcarbamimidoyl) 2-[(3,5-ditert-butylphenyl)methylamino]acetate |
| SMILES | CC(C)(C)c1cc(CNCC(=O)O/C(=N\C2CCCCC2)NC2CCCCC2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H49N3O2/c1-29(2,3)23-17-22(18-24(19-23)30(4,5)6)20-31-21-27(34)35-28(32-25-13-9-7-10-14-25)33-26-15-11-8-12-16-26/h17-19,25-26,31H,7-16,20-21H2,1-6H3,(H,32,33) |
| InChIKey | BLGLASMGSSCRKE-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.74 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|