C23H37N7O4 — CID 102371598
(N,N'-dicyclohexylcarbamimidoyl) 4-(2,4-dimethyl-1-oxido-3-oxo-1H-imidazo[4,5-e][1,2,4]triazin-1-ium-7-yl)butanoate (PubChem CID 102371598) has the molecular formula C23H37N7O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is (N,N'-dicyclohexylcarbamimidoyl) 4-(2,4-dimethyl-1-oxido-3-oxo-1H-imidazo[4,5-e][1,2,4]triazin-1-ium-7-yl)butanoate.
| Compound Name | (N,N'-dicyclohexylcarbamimidoyl) 4-(2,4-dimethyl-1-oxido-3-oxo-1H-imidazo[4,5-e][1,2,4]triazin-1-ium-7-yl)butanoate |
|---|---|
| PubChem CID | 102371598 |
| Molecular Formula | C23H37N7O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | (N,N'-dicyclohexylcarbamimidoyl) 4-(2,4-dimethyl-1-oxido-3-oxo-1H-imidazo[4,5-e][1,2,4]triazin-1-ium-7-yl)butanoate |
| SMILES | CN1C(=O)N(C)[NH+]([O-])c2c1ncn2CCCC(=O)O/C(=N\C1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C23H37N7O4/c1-27-20-21(30(33)28(2)23(27)32)29(16-24-20)15-9-14-19(31)34-22(25-17-10-5-3-6-11-17)26-18-12-7-4-8-13-18/h16-18,30H,3-15H2,1-2H3,(H,25,26) |
| InChIKey | IWEBESSCOCBKMD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|