C28H29N3O2 — CID 134846431
[C-[(Z)-N-anilino-C-(4-methylphenyl)carbonimidoyl]-N-cyclohexylcarbonimidoyl] benzoate (PubChem CID 134846431) has the molecular formula C28H29N3O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is [C-[(Z)-N-anilino-C-(4-methylphenyl)carbonimidoyl]-N-cyclohexylcarbonimidoyl] benzoate.
| Compound Name | [C-[(Z)-N-anilino-C-(4-methylphenyl)carbonimidoyl]-N-cyclohexylcarbonimidoyl] benzoate |
|---|---|
| PubChem CID | 134846431 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | [C-[(Z)-N-anilino-C-(4-methylphenyl)carbonimidoyl]-N-cyclohexylcarbonimidoyl] benzoate |
| SMILES | Cc1ccc(C(=N/Nc2ccccc2)/C(=N/C2CCCCC2)OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H29N3O2/c1-21-17-19-22(20-18-21)26(31-30-25-15-9-4-10-16-25)27(29-24-13-7-3-8-14-24)33-28(32)23-11-5-2-6-12-23/h2,4-6,9-12,15-20,24,30H,3,7-8,13-14H2,1H3/b29-27-,31-26- |
| InChIKey | KHSWAQSISVRPID-MUKHHDCDSA-N |
| XLogP | 6.40 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|