C15H24Cl2N2O — CID 101418661
N-(2-chloroacetyl)-N,N'-dicyclohexylcarbamimidoyl chloride (PubChem CID 101418661) has the molecular formula C15H24Cl2N2O and a molecular weight of 319.28 g/mol. Its IUPAC name is N-(2-chloroacetyl)-N,N'-dicyclohexylcarbamimidoyl chloride.
| Compound Name | N-(2-chloroacetyl)-N,N'-dicyclohexylcarbamimidoyl chloride |
|---|---|
| PubChem CID | 101418661 |
| Molecular Formula | C15H24Cl2N2O |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | N-(2-chloroacetyl)-N,N'-dicyclohexylcarbamimidoyl chloride |
| SMILES | O=C(CCl)N(/C(Cl)=N/C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C15H24Cl2N2O/c16-11-14(20)19(13-9-5-2-6-10-13)15(17)18-12-7-3-1-4-8-12/h12-13H,1-11H2/b18-15+ |
| InChIKey | BFBZPECNLFFBFR-OBGWFSINSA-N |
| XLogP | 4.31 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|