C21H20ClF3N2O — CID 102194055
N'-cyclohexyl-N-phenyl-N-[4-(trifluoromethyl)benzoyl]carbamimidoyl chloride (PubChem CID 102194055) has the molecular formula C21H20ClF3N2O and a molecular weight of 408.85 g/mol. Its IUPAC name is N'-cyclohexyl-N-phenyl-N-[4-(trifluoromethyl)benzoyl]carbamimidoyl chloride.
| Compound Name | N'-cyclohexyl-N-phenyl-N-[4-(trifluoromethyl)benzoyl]carbamimidoyl chloride |
|---|---|
| PubChem CID | 102194055 |
| Molecular Formula | C21H20ClF3N2O |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | N'-cyclohexyl-N-phenyl-N-[4-(trifluoromethyl)benzoyl]carbamimidoyl chloride |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N(/C(Cl)=N/C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C21H20ClF3N2O/c22-20(26-17-7-3-1-4-8-17)27(18-9-5-2-6-10-18)19(28)15-11-13-16(14-12-15)21(23,24)25/h2,5-6,9-14,17H,1,3-4,7-8H2/b26-20+ |
| InChIKey | WJVRPMMAQUPVSK-LHLOQNFPSA-N |
| XLogP | 6.28 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|