C21H23F3N4O2 — CID 57378361
N-[N'-cycloheptyl-N-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]-4-(trifluoromethyl)benzamide (PubChem CID 57378361) has the molecular formula C21H23F3N4O2 and a molecular weight of 420.44 g/mol. Its IUPAC name is N-[N'-cycloheptyl-N-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[N'-cycloheptyl-N-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 57378361 |
| Molecular Formula | C21H23F3N4O2 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-[N'-cycloheptyl-N-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(N/C(=N\C1CCCCCC1)Nc1cccc(=O)[nH]1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H23F3N4O2/c22-21(23,24)15-12-10-14(11-13-15)19(30)28-20(25-16-6-3-1-2-4-7-16)27-17-8-5-9-18(29)26-17/h5,8-13,16H,1-4,6-7H2,(H3,25,26,27,28,29,30) |
| InChIKey | IVANURLAQSRFGG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|