C18H17F6N5O — CID 88534785
N-[N'-cyclopentyl-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-4-(trifluoromethyl)benzamide (PubChem CID 88534785) has the molecular formula C18H17F6N5O and a molecular weight of 433.36 g/mol. Its IUPAC name is N-[N'-cyclopentyl-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[N'-cyclopentyl-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 88534785 |
| Molecular Formula | C18H17F6N5O |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N-[N'-cyclopentyl-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(N/C(=N/C1CCCC1)Nc1cc(C(F)(F)F)[nH]n1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F6N5O/c19-17(20,21)11-7-5-10(6-8-11)15(30)27-16(25-12-3-1-2-4-12)26-14-9-13(28-29-14)18(22,23)24/h5-9,12H,1-4H2,(H3,25,26,27,28,29,30) |
| InChIKey | JFCVIAWTNJOTPJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|