C18H20F5N5O — CID 67965725
4-(difluoromethyl)-N-[N'-(2,2-dimethylpropyl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]benzamide (PubChem CID 67965725) has the molecular formula C18H20F5N5O and a molecular weight of 417.38 g/mol. Its IUPAC name is 4-(difluoromethyl)-N-[N'-(2,2-dimethylpropyl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]benzamide.
| Compound Name | 4-(difluoromethyl)-N-[N'-(2,2-dimethylpropyl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 67965725 |
| Molecular Formula | C18H20F5N5O |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 4-(difluoromethyl)-N-[N'-(2,2-dimethylpropyl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]benzamide |
| SMILES | CC(C)(C)C/N=C(\NC(=O)c1ccc(C(F)F)cc1)Nc1cc(C(F)(F)F)[nH]n1 |
| InChI | InChI=1S/C18H20F5N5O/c1-17(2,3)9-24-16(25-13-8-12(27-28-13)18(21,22)23)26-15(29)11-6-4-10(5-7-11)14(19)20/h4-8,14H,9H2,1-3H3,(H3,24,25,26,27,28,29) |
| InChIKey | IDLZANYSRSMQRG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|