C18H22F3N5O2 — CID 118375506
N-[N'-(3-ethoxypropyl)-N-(5-methyl-1H-pyrazol-3-yl)carbamimidoyl]-4-(trifluoromethyl)benzamide (PubChem CID 118375506) has the molecular formula C18H22F3N5O2 and a molecular weight of 397.40 g/mol. Its IUPAC name is N-[N'-(3-ethoxypropyl)-N-(5-methyl-1H-pyrazol-3-yl)carbamimidoyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[N'-(3-ethoxypropyl)-N-(5-methyl-1H-pyrazol-3-yl)carbamimidoyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118375506 |
| Molecular Formula | C18H22F3N5O2 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-[N'-(3-ethoxypropyl)-N-(5-methyl-1H-pyrazol-3-yl)carbamimidoyl]-4-(trifluoromethyl)benzamide |
| SMILES | CCOCCC/N=C(/NC(=O)c1ccc(C(F)(F)F)cc1)Nc1cc(C)[nH]n1 |
| InChI | InChI=1S/C18H22F3N5O2/c1-3-28-10-4-9-22-17(23-15-11-12(2)25-26-15)24-16(27)13-5-7-14(8-6-13)18(19,20)21/h5-8,11H,3-4,9-10H2,1-2H3,(H3,22,23,24,25,26,27) |
| InChIKey | CRLFNCMCSZQXCH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|