C29H28F3N5O2 — CID 67960645
N-[N'-tert-butyl-N-[5-(4-phenylmethoxyphenyl)-1H-pyrazol-3-yl]carbamimidoyl]-4-(trifluoromethyl)benzamide (PubChem CID 67960645) has the molecular formula C29H28F3N5O2 and a molecular weight of 535.57 g/mol. Its IUPAC name is N-[N'-tert-butyl-N-[5-(4-phenylmethoxyphenyl)-1H-pyrazol-3-yl]carbamimidoyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[N'-tert-butyl-N-[5-(4-phenylmethoxyphenyl)-1H-pyrazol-3-yl]carbamimidoyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 67960645 |
| Molecular Formula | C29H28F3N5O2 |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | N-[N'-tert-butyl-N-[5-(4-phenylmethoxyphenyl)-1H-pyrazol-3-yl]carbamimidoyl]-4-(trifluoromethyl)benzamide |
| SMILES | CC(C)(C)/N=C(/NC(=O)c1ccc(C(F)(F)F)cc1)Nc1cc(-c2ccc(OCc3ccccc3)cc2)[nH]n1 |
| InChI | InChI=1S/C29H28F3N5O2/c1-28(2,3)35-27(34-26(38)21-9-13-22(14-10-21)29(30,31)32)33-25-17-24(36-37-25)20-11-15-23(16-12-20)39-18-19-7-5-4-6-8-19/h4-17H,18H2,1-3H3,(H3,33,34,35,36,37,38) |
| InChIKey | DVOBYGHNIPVGBL-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|