C22H21F4N5O3 — CID 137092956
N-[N-[5-(2-fluoro-4-hydroxyphenyl)-1H-pyrazol-3-yl]-N'-[(2S)-1-methoxypropan-2-yl]carbamimidoyl]-4-(trifluoromethyl)benzamide (PubChem CID 137092956) has the molecular formula C22H21F4N5O3 and a molecular weight of 479.43 g/mol. Its IUPAC name is N-[N-[5-(2-fluoro-4-hydroxyphenyl)-1H-pyrazol-3-yl]-N'-[(2S)-1-methoxypropan-2-yl]carbamimidoyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[N-[5-(2-fluoro-4-hydroxyphenyl)-1H-pyrazol-3-yl]-N'-[(2S)-1-methoxypropan-2-yl]carbamimidoyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 137092956 |
| Molecular Formula | C22H21F4N5O3 |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | N-[N-[5-(2-fluoro-4-hydroxyphenyl)-1H-pyrazol-3-yl]-N'-[(2S)-1-methoxypropan-2-yl]carbamimidoyl]-4-(trifluoromethyl)benzamide |
| SMILES | COC[C@H](C)/N=C(\NC(=O)c1ccc(C(F)(F)F)cc1)Nc1cc(-c2ccc(O)cc2F)[nH]n1 |
| InChI | InChI=1S/C22H21F4N5O3/c1-12(11-34-2)27-21(29-20(33)13-3-5-14(6-4-13)22(24,25)26)28-19-10-18(30-31-19)16-8-7-15(32)9-17(16)23/h3-10,12,32H,11H2,1-2H3,(H3,27,28,29,30,31,33)/t12-/m0/s1 |
| InChIKey | BMYRIGONCAONEQ-LBPRGKRZSA-N |
| XLogP | 4.17 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|