C25H27F5N6O3 — CID 118105603
N-[N-[1-(2-amino-3-methylbutanoyl)-6-(trifluoromethyl)indazol-3-yl]-N'-[(2S)-1-methoxypropan-2-yl]carbamimidoyl]-3,4-difluorobenzamide (PubChem CID 118105603) has the molecular formula C25H27F5N6O3 and a molecular weight of 554.52 g/mol. Its IUPAC name is N-[N-[1-(2-amino-3-methylbutanoyl)-6-(trifluoromethyl)indazol-3-yl]-N'-[(2S)-1-methoxypropan-2-yl]carbamimidoyl]-3,4-difluorobenzamide.
| Compound Name | N-[N-[1-(2-amino-3-methylbutanoyl)-6-(trifluoromethyl)indazol-3-yl]-N'-[(2S)-1-methoxypropan-2-yl]carbamimidoyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 118105603 |
| Molecular Formula | C25H27F5N6O3 |
| Molecular Weight | 554.52 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | N-[N-[1-(2-amino-3-methylbutanoyl)-6-(trifluoromethyl)indazol-3-yl]-N'-[(2S)-1-methoxypropan-2-yl]carbamimidoyl]-3,4-difluorobenzamide |
| SMILES | COC[C@H](C)/N=C(\NC(=O)c1ccc(F)c(F)c1)Nc1nn(C(=O)C(N)C(C)C)c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C25H27F5N6O3/c1-12(2)20(31)23(38)36-19-10-15(25(28,29)30)6-7-16(19)21(35-36)33-24(32-13(3)11-39-4)34-22(37)14-5-8-17(26)18(27)9-14/h5-10,12-13,20H,11,31H2,1-4H3,(H2,32,33,34,35,37)/t13-,20?/m0/s1 |
| InChIKey | DTSHALFGUYBASM-SZQRVLIRSA-N |
| XLogP | 4.19 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|