C20H20F3N5O2 — CID 123521278
3,4-difluoro-N-[N-(6-fluoro-1-methylindazol-3-yl)-N'-(2-hydroxy-2-methylpropyl)carbamimidoyl]benzamide (PubChem CID 123521278) has the molecular formula C20H20F3N5O2 and a molecular weight of 419.41 g/mol. Its IUPAC name is 3,4-difluoro-N-[N-(6-fluoro-1-methylindazol-3-yl)-N'-(2-hydroxy-2-methylpropyl)carbamimidoyl]benzamide.
| Compound Name | 3,4-difluoro-N-[N-(6-fluoro-1-methylindazol-3-yl)-N'-(2-hydroxy-2-methylpropyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 123521278 |
| Molecular Formula | C20H20F3N5O2 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 3,4-difluoro-N-[N-(6-fluoro-1-methylindazol-3-yl)-N'-(2-hydroxy-2-methylpropyl)carbamimidoyl]benzamide |
| SMILES | Cn1nc(N/C(=N/CC(C)(C)O)NC(=O)c2ccc(F)c(F)c2)c2ccc(F)cc21 |
| InChI | InChI=1S/C20H20F3N5O2/c1-20(2,30)10-24-19(26-18(29)11-4-7-14(22)15(23)8-11)25-17-13-6-5-12(21)9-16(13)28(3)27-17/h4-9,30H,10H2,1-3H3,(H2,24,25,26,27,29) |
| InChIKey | FBNGFQSHHRIWQV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|