C21H21F4N3O2 — CID 57382816
N-[N'-[(2,4-difluorophenyl)methyl]-N-(4-hydroxycyclohexyl)carbamimidoyl]-3,4-difluorobenzamide (PubChem CID 57382816) has the molecular formula C21H21F4N3O2 and a molecular weight of 423.41 g/mol. Its IUPAC name is N-[N'-[(2,4-difluorophenyl)methyl]-N-(4-hydroxycyclohexyl)carbamimidoyl]-3,4-difluorobenzamide.
| Compound Name | N-[N'-[(2,4-difluorophenyl)methyl]-N-(4-hydroxycyclohexyl)carbamimidoyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 57382816 |
| Molecular Formula | C21H21F4N3O2 |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N-[N'-[(2,4-difluorophenyl)methyl]-N-(4-hydroxycyclohexyl)carbamimidoyl]-3,4-difluorobenzamide |
| SMILES | O=C(N/C(=N\Cc1ccc(F)cc1F)NC1CCC(O)CC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H21F4N3O2/c22-14-3-1-13(18(24)10-14)11-26-21(27-15-4-6-16(29)7-5-15)28-20(30)12-2-8-17(23)19(25)9-12/h1-3,8-10,15-16,29H,4-7,11H2,(H2,26,27,28,30) |
| InChIKey | IDMQBDNJOSYNHG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|