C20H19ClF5N5O — CID 118375785
N-[N'-[(2-chloro-4-fluorophenyl)methyl]-N-[5-(trifluoromethyl)pyrazolidin-3-yl]carbamimidoyl]-4-fluoro-3-methylbenzamide (PubChem CID 118375785) has the molecular formula C20H19ClF5N5O and a molecular weight of 475.85 g/mol. Its IUPAC name is N-[N'-[(2-chloro-4-fluorophenyl)methyl]-N-[5-(trifluoromethyl)pyrazolidin-3-yl]carbamimidoyl]-4-fluoro-3-methylbenzamide.
| Compound Name | N-[N'-[(2-chloro-4-fluorophenyl)methyl]-N-[5-(trifluoromethyl)pyrazolidin-3-yl]carbamimidoyl]-4-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 118375785 |
| Molecular Formula | C20H19ClF5N5O |
| Molecular Weight | 475.85 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | N-[N'-[(2-chloro-4-fluorophenyl)methyl]-N-[5-(trifluoromethyl)pyrazolidin-3-yl]carbamimidoyl]-4-fluoro-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)N/C(=N\Cc2ccc(F)cc2Cl)NC2CC(C(F)(F)F)NN2)ccc1F |
| InChI | InChI=1S/C20H19ClF5N5O/c1-10-6-11(3-5-15(10)23)18(32)29-19(27-9-12-2-4-13(22)7-14(12)21)28-17-8-16(30-31-17)20(24,25)26/h2-7,16-17,30-31H,8-9H2,1H3,(H2,27,28,29,32) |
| InChIKey | LJYOJMFLERMDKI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.85 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|