C23H26ClF2N5O2 — CID 118375521
4-chloro-3-fluoro-N-[N-[5-(4-fluorophenyl)pyrazolidin-3-yl]-N'-[(2-methyloxolan-2-yl)methyl]carbamimidoyl]benzamide (PubChem CID 118375521) has the molecular formula C23H26ClF2N5O2 and a molecular weight of 477.94 g/mol. Its IUPAC name is 4-chloro-3-fluoro-N-[N-[5-(4-fluorophenyl)pyrazolidin-3-yl]-N'-[(2-methyloxolan-2-yl)methyl]carbamimidoyl]benzamide.
| Compound Name | 4-chloro-3-fluoro-N-[N-[5-(4-fluorophenyl)pyrazolidin-3-yl]-N'-[(2-methyloxolan-2-yl)methyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 118375521 |
| Molecular Formula | C23H26ClF2N5O2 |
| Molecular Weight | 477.94 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 4-chloro-3-fluoro-N-[N-[5-(4-fluorophenyl)pyrazolidin-3-yl]-N'-[(2-methyloxolan-2-yl)methyl]carbamimidoyl]benzamide |
| SMILES | CC1(C/N=C(\NC(=O)c2ccc(Cl)c(F)c2)NC2CC(c3ccc(F)cc3)NN2)CCCO1 |
| InChI | InChI=1S/C23H26ClF2N5O2/c1-23(9-2-10-33-23)13-27-22(29-21(32)15-5-8-17(24)18(26)11-15)28-20-12-19(30-31-20)14-3-6-16(25)7-4-14/h3-8,11,19-20,30-31H,2,9-10,12-13H2,1H3,(H2,27,28,29,32) |
| InChIKey | OYIDLQFAPTUSGU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.94 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|